C30H23Cl2F5N2O3 — CID 87344789
(2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-methyl-2-phenylpropyl)pyrrolidine-2-carboxylate (PubChem CID 87344789) has the molecular formula C30H23Cl2F5N2O3 and a molecular weight of 625.42 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-methyl-2-phenylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-methyl-2-phenylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87344789 |
| Molecular Formula | C30H23Cl2F5N2O3 |
| Molecular Weight | 625.42 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2-methyl-2-phenylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C[C@@H]1N[C@@H](C(=O)OC(=O)C(F)(F)F)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F)c1ccccc1 |
| InChI | InChI=1S/C30H23Cl2F5N2O3/c1-28(2,16-7-4-3-5-8-16)14-22-29(15-38,19-12-11-17(31)13-21(19)33)23(18-9-6-10-20(32)24(18)34)25(39-22)26(40)42-27(41)30(35,36)37/h3-13,22-23,25,39H,14H2,1-2H3/t22-,23-,25+,29-/m0/s1 |
| InChIKey | DYRUHIKRDGTKDJ-ILRKGFAZSA-N |
| XLogP | 7.16 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.42 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|