(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide

C19H43NO — CID 87346379

IUPAC(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide
SMILESCCCCC(C)(CCCC)C([NH3+])(CCCC)CCCC.[OH-]
InChIInChI=1S/C19H41N.H2O/c1-6-10-14-18(5,15-11-7-2)19(20,16-12-8-3)17-13-9-4;/h6-17,20H2,1-5H3;1H2
InChIKeyDILAXALMTJYOIE-UHFFFAOYSA-N
MW301.56 g/mol
LogP5.56
Rot. Bonds13

About (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide

(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide (PubChem CID 87346379) has the molecular formula C19H43NO and a molecular weight of 301.56 g/mol. Its IUPAC name is (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide.

Molecular Properties

Compound Name(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide
PubChem CID87346379
Molecular FormulaC19H43NO
Molecular Weight301.56 g/mol
Exact Mass301.33
IUPAC Name(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide
SMILESCCCCC(C)(CCCC)C([NH3+])(CCCC)CCCC.[OH-]
InChIInChI=1S/C19H41N.H2O/c1-6-10-14-18(5,15-11-7-2)19(20,16-12-8-3)17-13-9-4;/h6-17,20H2,1-5H3;1H2
InChIKeyDILAXALMTJYOIE-UHFFFAOYSA-N
XLogP5.56
TPSA57.64 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500301.56
LogP ≤ 55.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide?
The IUPAC name of (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide (CID 87346379) is (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide.
What is the SMILES notation for (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide?
The canonical SMILES for (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide is CCCCC(C)(CCCC)C([NH3+])(CCCC)CCCC.[OH-].
What is the InChIKey of (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide?
The InChIKey is DILAXALMTJYOIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41N.H2O/c1-6-10-14-18(5,15-11-7-2)19(20,16-12-8-3)17-13-9-4;/h6-17,20H2,1-5H3;1H2.
What are the key properties of (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide?
(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide has a molecular weight of 301.56 g/mol, XLogP of 5.56, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide is sourced from PubChem (CID 87346379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).