C19H43NO — CID 87346379
(5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide (PubChem CID 87346379) has the molecular formula C19H43NO and a molecular weight of 301.56 g/mol. Its IUPAC name is (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide.
| Compound Name | (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide |
|---|---|
| PubChem CID | 87346379 |
| Molecular Formula | C19H43NO |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 301.33 |
| IUPAC Name | (5,6-dibutyl-6-methyldecan-5-yl)azanium hydroxide |
| SMILES | CCCCC(C)(CCCC)C([NH3+])(CCCC)CCCC.[OH-] |
| InChI | InChI=1S/C19H41N.H2O/c1-6-10-14-18(5,15-11-7-2)19(20,16-12-8-3)17-13-9-4;/h6-17,20H2,1-5H3;1H2 |
| InChIKey | DILAXALMTJYOIE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |