C11H27N3O3S — CID 87347131
pentane-1-sulfonamide;pentylurea (PubChem CID 87347131) has the molecular formula C11H27N3O3S and a molecular weight of 281.42 g/mol. Its IUPAC name is pentane-1-sulfonamide;pentylurea.
| Compound Name | pentane-1-sulfonamide;pentylurea |
|---|---|
| PubChem CID | 87347131 |
| Molecular Formula | C11H27N3O3S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | pentane-1-sulfonamide;pentylurea |
| SMILES | CCCCCNC(N)=O.CCCCCS(N)(=O)=O |
| InChI | InChI=1S/C6H14N2O.C5H13NO2S/c1-2-3-4-5-8-6(7)9;1-2-3-4-5-9(6,7)8/h2-5H2,1H3,(H3,7,8,9);2-5H2,1H3,(H2,6,7,8) |
| InChIKey | OWSXWOPSHWFOOS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|