C12H25N3O4S — CID 2333272
3-(butylcarbamoyl)-1-methylsulfonyl-1-pentylurea (PubChem CID 2333272) has the molecular formula C12H25N3O4S and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-(butylcarbamoyl)-1-methylsulfonyl-1-pentylurea.
| Compound Name | 3-(butylcarbamoyl)-1-methylsulfonyl-1-pentylurea |
|---|---|
| PubChem CID | 2333272 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-(butylcarbamoyl)-1-methylsulfonyl-1-pentylurea |
| SMILES | CCCCCN(C(=O)NC(=O)NCCCC)S(C)(=O)=O |
| InChI | InChI=1S/C12H25N3O4S/c1-4-6-8-10-15(20(3,18)19)12(17)14-11(16)13-9-7-5-2/h4-10H2,1-3H3,(H2,13,14,16,17) |
| InChIKey | WHQVDSNWJFJIOO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|