C11H23N3O5S — CID 2333370
3-(2-methoxyethylcarbamoyl)-1-methylsulfonyl-1-pentylurea (PubChem CID 2333370) has the molecular formula C11H23N3O5S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-(2-methoxyethylcarbamoyl)-1-methylsulfonyl-1-pentylurea.
| Compound Name | 3-(2-methoxyethylcarbamoyl)-1-methylsulfonyl-1-pentylurea |
|---|---|
| PubChem CID | 2333370 |
| Molecular Formula | C11H23N3O5S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-(2-methoxyethylcarbamoyl)-1-methylsulfonyl-1-pentylurea |
| SMILES | CCCCCN(C(=O)NC(=O)NCCOC)S(C)(=O)=O |
| InChI | InChI=1S/C11H23N3O5S/c1-4-5-6-8-14(20(3,17)18)11(16)13-10(15)12-7-9-19-2/h4-9H2,1-3H3,(H2,12,13,15,16) |
| InChIKey | QXBYOMFVBAOHAL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|