C16H24N4O7S — CID 3676058
3-[[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamoyl]-1-methylsulfonyl-1-pentylurea (PubChem CID 3676058) has the molecular formula C16H24N4O7S and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-[[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamoyl]-1-methylsulfonyl-1-pentylurea.
| Compound Name | 3-[[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamoyl]-1-methylsulfonyl-1-pentylurea |
|---|---|
| PubChem CID | 3676058 |
| Molecular Formula | C16H24N4O7S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamoyl]-1-methylsulfonyl-1-pentylurea |
| SMILES | CCCCCN(C(=O)NC(=O)NCC(O)c1ccc([N+](=O)[O-])cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H24N4O7S/c1-3-4-5-10-19(28(2,26)27)16(23)18-15(22)17-11-14(21)12-6-8-13(9-7-12)20(24)25/h6-9,14,21H,3-5,10-11H2,1-2H3,(H2,17,18,22,23) |
| InChIKey | FIYZNBKUNRWBHO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|