C12H19N5O4S — CID 2320654
1-methylsulfonyl-1-pentyl-3-(pyrimidin-2-ylcarbamoyl)urea (PubChem CID 2320654) has the molecular formula C12H19N5O4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-methylsulfonyl-1-pentyl-3-(pyrimidin-2-ylcarbamoyl)urea.
| Compound Name | 1-methylsulfonyl-1-pentyl-3-(pyrimidin-2-ylcarbamoyl)urea |
|---|---|
| PubChem CID | 2320654 |
| Molecular Formula | C12H19N5O4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-methylsulfonyl-1-pentyl-3-(pyrimidin-2-ylcarbamoyl)urea |
| SMILES | CCCCCN(C(=O)NC(=O)Nc1ncccn1)S(C)(=O)=O |
| InChI | InChI=1S/C12H19N5O4S/c1-3-4-5-9-17(22(2,20)21)12(19)16-11(18)15-10-13-7-6-8-14-10/h6-8H,3-5,9H2,1-2H3,(H2,13,14,15,16,18,19) |
| InChIKey | PAWDXCBSBKNQJU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|