C19H33N3O4S — CID 7689358
3-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-1-butyl-1-methylsulfonylurea (PubChem CID 7689358) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-1-butyl-1-methylsulfonylurea.
| Compound Name | 3-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-1-butyl-1-methylsulfonylurea |
|---|---|
| PubChem CID | 7689358 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[[(1S)-1-(1-adamantyl)ethyl]carbamoyl]-1-butyl-1-methylsulfonylurea |
| SMILES | CCCCN(C(=O)NC(=O)N[C@@H](C)C12CC3CC(CC(C3)C1)C2)S(C)(=O)=O |
| InChI | InChI=1S/C19H33N3O4S/c1-4-5-6-22(27(3,25)26)18(24)21-17(23)20-13(2)19-10-14-7-15(11-19)9-16(8-14)12-19/h13-16H,4-12H2,1-3H3,(H2,20,21,23,24)/t13-,14?,15?,16?,19?/m0/s1 |
| InChIKey | OPUYFDNFSHCVJP-IWUURBKTSA-N |
| XLogP | 3.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |