About (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate
(2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 87351409) has the molecular formula C14H9FN2O4
and a molecular weight of 288.23 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate |
| PubChem CID | 87351409 |
| Molecular Formula | C14H9FN2O4 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | N#C/C(=C/c1ccccc1F)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H9FN2O4/c15-11-4-2-1-3-9(11)7-10(8-16)14(20)21-17-12(18)5-6-13(17)19/h1-4,7H,5-6H2/b10-7- |
| InChIKey | JEBOWDRFMADEDJ-YFHOEESVSA-N |
| XLogP | 1.34 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate (CID 87351409) is (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate is N#C/C(=C/c1ccccc1F)C(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate?
The InChIKey is JEBOWDRFMADEDJ-YFHOEESVSA-N. The full InChI is InChI=1S/C14H9FN2O4/c15-11-4-2-1-3-9(11)7-10(8-16)14(20)21-17-12(18)5-6-13(17)19/h1-4,7H,5-6H2/b10-7-.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate?
(2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate has a molecular weight of 288.23 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (Z)-2-cyano-3-(2-fluorophenyl)prop-2-enoate is sourced from PubChem (CID 87351409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).