C20H16Cl2F2N4S2 — CID 87352618
5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 87352618) has the molecular formula C20H16Cl2F2N4S2 and a molecular weight of 485.41 g/mol. Its IUPAC name is 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87352618 |
| Molecular Formula | C20H16Cl2F2N4S2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(Cc2cccc(F)c2Cl)s1.Nc1ncc(Cc2cccc(F)c2Cl)s1 |
| InChI | InChI=1S/2C10H8ClFN2S/c2*11-9-6(2-1-3-8(9)12)4-7-5-14-10(13)15-7/h2*1-3,5H,4H2,(H2,13,14) |
| InChIKey | YPESBBHFWBMKEA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |