About 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine
5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 87352618) has the molecular formula C20H16Cl2F2N4S2
and a molecular weight of 485.41 g/mol. Its IUPAC name is 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 87352618 |
| Molecular Formula | C20H16Cl2F2N4S2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(Cc2cccc(F)c2Cl)s1.Nc1ncc(Cc2cccc(F)c2Cl)s1 |
| InChI | InChI=1S/2C10H8ClFN2S/c2*11-9-6(2-1-3-8(9)12)4-7-5-14-10(13)15-7/h2*1-3,5H,4H2,(H2,13,14) |
| InChIKey | YPESBBHFWBMKEA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine (CID 87352618) is 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine is Nc1ncc(Cc2cccc(F)c2Cl)s1.Nc1ncc(Cc2cccc(F)c2Cl)s1.
What is the InChIKey of 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine?
The InChIKey is YPESBBHFWBMKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H8ClFN2S/c2*11-9-6(2-1-3-8(9)12)4-7-5-14-10(13)15-7/h2*1-3,5H,4H2,(H2,13,14).
What are the key properties of 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine?
5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine has a molecular weight of 485.41 g/mol, XLogP of 6.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-chloro-3-fluorophenyl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 87352618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).