C20H21NO — CID 87353390
[5-(dimethylamino)cyclopenta-1,3-dien-1-yl]-diphenylmethanol (PubChem CID 87353390) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is [5-(dimethylamino)cyclopenta-1,3-dien-1-yl]-diphenylmethanol.
| Compound Name | [5-(dimethylamino)cyclopenta-1,3-dien-1-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 87353390 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | [5-(dimethylamino)cyclopenta-1,3-dien-1-yl]-diphenylmethanol |
| SMILES | CN(C)C1C=CC=C1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-21(2)19-15-9-14-18(19)20(22,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-15,19,22H,1-2H3 |
| InChIKey | QZQLOESWPYPRMB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |