C38H49ClN2O7S2 — CID 87355762
4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethyl-1H-indol-4-yl]butane-1-sulfonic acid hydroxide (PubChem CID 87355762) has the molecular formula C38H49ClN2O7S2 and a molecular weight of 745.40 g/mol. Its IUPAC name is 4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethyl-1H-indol-4-yl]butane-1-sulfonic acid hydroxide.
| Compound Name | 4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethyl-1H-indol-4-yl]butane-1-sulfonic acid hydroxide |
|---|---|
| PubChem CID | 87355762 |
| Molecular Formula | C38H49ClN2O7S2 |
| Molecular Weight | 745.40 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | 4-[2-[2-[2-chloro-3-[2-[3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-2-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3,3-dimethyl-1H-indol-4-yl]butane-1-sulfonic acid hydroxide |
| SMILES | CC1(C)C(C=CC2=C(Cl)C(=CC=C3Nc4cccc(CCCCS(=O)(=O)O)c4C3(C)C)CCC2)=[N+](CCCCS(=O)(=O)O)c2ccccc21.[OH-] |
| InChI | InChI=1S/C38H47ClN2O6S2.H2O/c1-37(2)30-17-5-6-19-32(30)41(24-8-10-26-49(45,46)47)34(37)23-21-29-16-11-15-28(36(29)39)20-22-33-38(3,4)35-27(14-12-18-31(35)40-33)13-7-9-25-48(42,43)44;/h5-6,12,14,17-23H,7-11,13,15-16,24-26H2,1-4H3,(H2,42,43,44,45,46,47);1H2 |
| InChIKey | LQELSNUVOAXWJO-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.40 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|