C23H44O7 — CID 87356581
19,20-dihydroxy-11-(2-hydroxyethoxycarbonyl)icosanoic acid (PubChem CID 87356581) has the molecular formula C23H44O7 and a molecular weight of 432.60 g/mol. Its IUPAC name is 19,20-dihydroxy-11-(2-hydroxyethoxycarbonyl)icosanoic acid.
| Compound Name | 19,20-dihydroxy-11-(2-hydroxyethoxycarbonyl)icosanoic acid |
|---|---|
| PubChem CID | 87356581 |
| Molecular Formula | C23H44O7 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 19,20-dihydroxy-11-(2-hydroxyethoxycarbonyl)icosanoic acid |
| SMILES | O=C(O)CCCCCCCCCC(CCCCCCCC(O)CO)C(=O)OCCO |
| InChI | InChI=1S/C23H44O7/c24-17-18-30-23(29)20(14-10-6-4-7-11-15-21(26)19-25)13-9-5-2-1-3-8-12-16-22(27)28/h20-21,24-26H,1-19H2,(H,27,28) |
| InChIKey | GOBRNFWZWHHTGD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|