C20H21F5N2O3S — CID 87356759
1,3-thiazol-4-ylmethyl 4-[2-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]ethyl]piperidine-1-carboxylate (PubChem CID 87356759) has the molecular formula C20H21F5N2O3S and a molecular weight of 464.46 g/mol. Its IUPAC name is 1,3-thiazol-4-ylmethyl 4-[2-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | 1,3-thiazol-4-ylmethyl 4-[2-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87356759 |
| Molecular Formula | C20H21F5N2O3S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 1,3-thiazol-4-ylmethyl 4-[2-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]ethyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1cscn1)N1CCC(CCOc2cccc(C(F)(F)C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H21F5N2O3S/c21-19(22,20(23,24)25)15-2-1-3-17(10-15)29-9-6-14-4-7-27(8-5-14)18(28)30-11-16-12-31-13-26-16/h1-3,10,12-14H,4-9,11H2 |
| InChIKey | NMFBKFDMGPSZOW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|