C14H16N2 — CID 87356844
3-(1-phenylethylamino)hex-5-ynenitrile (PubChem CID 87356844) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 3-(1-phenylethylamino)hex-5-ynenitrile.
| Compound Name | 3-(1-phenylethylamino)hex-5-ynenitrile |
|---|---|
| PubChem CID | 87356844 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-(1-phenylethylamino)hex-5-ynenitrile |
| SMILES | C#CCC(CC#N)NC(C)c1ccccc1 |
| InChI | InChI=1S/C14H16N2/c1-3-7-14(10-11-15)16-12(2)13-8-5-4-6-9-13/h1,4-6,8-9,12,14,16H,7,10H2,2H3 |
| InChIKey | SENXEYRQFFOQQF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|