C34H32Cl3N3O3 — CID 87357148
(E)-3-[3-chloro-4-[[5-[(3,4-dichlorophenyl)methoxy]-2-pyridinyl]oxy]-5-methylphenyl]-3-[4-[(4-methylphenyl)methyl]piperazin-1-yl]prop-2-enal (PubChem CID 87357148) has the molecular formula C34H32Cl3N3O3 and a molecular weight of 637.01 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[[5-[(3,4-dichlorophenyl)methoxy]-2-pyridinyl]oxy]-5-methylphenyl]-3-[4-[(4-methylphenyl)methyl]piperazin-1-yl]prop-2-enal.
| Compound Name | (E)-3-[3-chloro-4-[[5-[(3,4-dichlorophenyl)methoxy]-2-pyridinyl]oxy]-5-methylphenyl]-3-[4-[(4-methylphenyl)methyl]piperazin-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 87357148 |
| Molecular Formula | C34H32Cl3N3O3 |
| Molecular Weight | 637.01 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | (E)-3-[3-chloro-4-[[5-[(3,4-dichlorophenyl)methoxy]-2-pyridinyl]oxy]-5-methylphenyl]-3-[4-[(4-methylphenyl)methyl]piperazin-1-yl]prop-2-enal |
| SMILES | Cc1ccc(CN2CCN(/C(=C/C=O)c3cc(C)c(Oc4ccc(OCc5ccc(Cl)c(Cl)c5)cn4)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C34H32Cl3N3O3/c1-23-3-5-25(6-4-23)21-39-12-14-40(15-13-39)32(11-16-41)27-17-24(2)34(31(37)19-27)43-33-10-8-28(20-38-33)42-22-26-7-9-29(35)30(36)18-26/h3-11,16-20H,12-15,21-22H2,1-2H3/b32-11+ |
| InChIKey | PCRWPGWGTKZHKK-MPRHAZATSA-N |
| XLogP | 8.39 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.01 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|