C24H22ClNO4 — CID 67328238
3-[3-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]but-2-enoic acid (PubChem CID 67328238) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 3-[3-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]but-2-enoic acid.
| Compound Name | 3-[3-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 67328238 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-[3-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)c1cc(C)c(Oc2ccc(OCc3ccc(C)cc3)cn2)c(Cl)c1 |
| InChI | InChI=1S/C24H22ClNO4/c1-15-4-6-18(7-5-15)14-29-20-8-9-22(26-13-20)30-24-17(3)10-19(12-21(24)25)16(2)11-23(27)28/h4-13H,14H2,1-3H3,(H,27,28) |
| InChIKey | CZONFTKMLBFOFH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|