C27H28ClNO4 — CID 67327059
2-[[2-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]methylidene]hexanoic acid (PubChem CID 67327059) has the molecular formula C27H28ClNO4 and a molecular weight of 465.98 g/mol. Its IUPAC name is 2-[[2-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]methylidene]hexanoic acid.
| Compound Name | 2-[[2-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]methylidene]hexanoic acid |
|---|---|
| PubChem CID | 67327059 |
| Molecular Formula | C27H28ClNO4 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[[2-chloro-5-methyl-4-[[5-[(4-methylphenyl)methoxy]-2-pyridinyl]oxy]phenyl]methylidene]hexanoic acid |
| SMILES | CCCCC(=Cc1cc(C)c(Oc2ccc(OCc3ccc(C)cc3)cn2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C27H28ClNO4/c1-4-5-6-21(27(30)31)14-22-13-19(3)25(15-24(22)28)33-26-12-11-23(16-29-26)32-17-20-9-7-18(2)8-10-20/h7-16H,4-6,17H2,1-3H3,(H,30,31) |
| InChIKey | KFTFXABLVBRTLA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|