C23H17ClN2O4 — CID 89123332
(E)-3-[5-chloro-4-[[5-[(4-cyanophenyl)methoxy]-2-pyridinyl]oxy]-2-methylphenyl]prop-2-enoic acid (PubChem CID 89123332) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is (E)-3-[5-chloro-4-[[5-[(4-cyanophenyl)methoxy]-2-pyridinyl]oxy]-2-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-4-[[5-[(4-cyanophenyl)methoxy]-2-pyridinyl]oxy]-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89123332 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (E)-3-[5-chloro-4-[[5-[(4-cyanophenyl)methoxy]-2-pyridinyl]oxy]-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Oc2ccc(OCc3ccc(C#N)cc3)cn2)c(Cl)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C23H17ClN2O4/c1-15-10-21(20(24)11-18(15)6-9-23(27)28)30-22-8-7-19(13-26-22)29-14-17-4-2-16(12-25)3-5-17/h2-11,13H,14H2,1H3,(H,27,28)/b9-6+ |
| InChIKey | JNGIDIOESOSTGE-RMKNXTFCSA-N |
| XLogP | 5.38 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|