C32H35F3O4 — CID 118726940
(2E)-2-[[5-[(4-butylphenyl)methoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]hexanoic acid (PubChem CID 118726940) has the molecular formula C32H35F3O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is (2E)-2-[[5-[(4-butylphenyl)methoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]hexanoic acid.
| Compound Name | (2E)-2-[[5-[(4-butylphenyl)methoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]hexanoic acid |
|---|---|
| PubChem CID | 118726940 |
| Molecular Formula | C32H35F3O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (2E)-2-[[5-[(4-butylphenyl)methoxy]-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]hexanoic acid |
| SMILES | CCCC/C(=C\c1cc(OCc2ccc(CCCC)cc2)ccc1OCc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C32H35F3O4/c1-3-5-7-23-9-11-24(12-10-23)21-38-29-17-18-30(27(20-29)19-26(31(36)37)8-6-4-2)39-22-25-13-15-28(16-14-25)32(33,34)35/h9-20H,3-8,21-22H2,1-2H3,(H,36,37)/b26-19+ |
| InChIKey | IUMONHZAPCDTCK-LGUFXXKBSA-N |
| XLogP | 8.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|