C31H28F3NO5 — CID 155527281
(2E)-2-[[5-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]-2-phenylmethoxyphenyl]methylidene]pentanoic acid (PubChem CID 155527281) has the molecular formula C31H28F3NO5 and a molecular weight of 551.56 g/mol. Its IUPAC name is (2E)-2-[[5-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]-2-phenylmethoxyphenyl]methylidene]pentanoic acid.
| Compound Name | (2E)-2-[[5-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]-2-phenylmethoxyphenyl]methylidene]pentanoic acid |
|---|---|
| PubChem CID | 155527281 |
| Molecular Formula | C31H28F3NO5 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | (2E)-2-[[5-[[4-methoxy-2-(trifluoromethyl)quinolin-6-yl]methoxy]-2-phenylmethoxyphenyl]methylidene]pentanoic acid |
| SMILES | CCC/C(=C\c1cc(OCc2ccc3nc(C(F)(F)F)cc(OC)c3c2)ccc1OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H28F3NO5/c1-3-7-22(30(36)37)15-23-16-24(11-13-27(23)40-18-20-8-5-4-6-9-20)39-19-21-10-12-26-25(14-21)28(38-2)17-29(35-26)31(32,33)34/h4-6,8-17H,3,7,18-19H2,1-2H3,(H,36,37)/b22-15+ |
| InChIKey | WAEKBQCNYPUWJO-PXLXIMEGSA-N |
| XLogP | 7.69 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|