C27H59NO5P2 — CID 87358847
N,N-bis[2-[3,3-di(propan-2-yloxy)propylphosphanyl]ethyl]-2-propan-2-yloxyethanamine (PubChem CID 87358847) has the molecular formula C27H59NO5P2 and a molecular weight of 539.72 g/mol. Its IUPAC name is N,N-bis[2-[3,3-di(propan-2-yloxy)propylphosphanyl]ethyl]-2-propan-2-yloxyethanamine.
| Compound Name | N,N-bis[2-[3,3-di(propan-2-yloxy)propylphosphanyl]ethyl]-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 87358847 |
| Molecular Formula | C27H59NO5P2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.39 |
| IUPAC Name | N,N-bis[2-[3,3-di(propan-2-yloxy)propylphosphanyl]ethyl]-2-propan-2-yloxyethanamine |
| SMILES | CC(C)OCCN(CCPCCC(OC(C)C)OC(C)C)CCPCCC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C27H59NO5P2/c1-21(2)29-16-13-28(14-19-34-17-11-26(30-22(3)4)31-23(5)6)15-20-35-18-12-27(32-24(7)8)33-25(9)10/h21-27,34-35H,11-20H2,1-10H3 |
| InChIKey | BKCATERYRVLZRU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|