C20H21BrN2O4 — CID 87359825
[(2S)-5-amino-2-[(3-methylphenyl)methylamino]-5-oxopentanoyl] 4-bromobenzoate (PubChem CID 87359825) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is [(2S)-5-amino-2-[(3-methylphenyl)methylamino]-5-oxopentanoyl] 4-bromobenzoate.
| Compound Name | [(2S)-5-amino-2-[(3-methylphenyl)methylamino]-5-oxopentanoyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 87359825 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [(2S)-5-amino-2-[(3-methylphenyl)methylamino]-5-oxopentanoyl] 4-bromobenzoate |
| SMILES | Cc1cccc(CN[C@@H](CCC(N)=O)C(=O)OC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H21BrN2O4/c1-13-3-2-4-14(11-13)12-23-17(9-10-18(22)24)20(26)27-19(25)15-5-7-16(21)8-6-15/h2-8,11,17,23H,9-10,12H2,1H3,(H2,22,24)/t17-/m0/s1 |
| InChIKey | RRPQWJLXNUAMTR-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|