C27H28N2O6 — CID 87658468
[(2S)-5-amino-2-[(3,5-dimethoxyphenyl)methylamino]-5-oxopentanoyl] 4-phenylbenzoate (PubChem CID 87658468) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [(2S)-5-amino-2-[(3,5-dimethoxyphenyl)methylamino]-5-oxopentanoyl] 4-phenylbenzoate.
| Compound Name | [(2S)-5-amino-2-[(3,5-dimethoxyphenyl)methylamino]-5-oxopentanoyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 87658468 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [(2S)-5-amino-2-[(3,5-dimethoxyphenyl)methylamino]-5-oxopentanoyl] 4-phenylbenzoate |
| SMILES | COc1cc(CN[C@@H](CCC(N)=O)C(=O)OC(=O)c2ccc(-c3ccccc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C27H28N2O6/c1-33-22-14-18(15-23(16-22)34-2)17-29-24(12-13-25(28)30)27(32)35-26(31)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h3-11,14-16,24,29H,12-13,17H2,1-2H3,(H2,28,30)/t24-/m0/s1 |
| InChIKey | RIQBXYWEJDBVDI-DEOSSOPVSA-N |
| XLogP | 3.48 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|