C28H28Cl2N2O4 — CID 87359870
[(2S)-5-amino-2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-5-oxopentanoyl] 4-(3-chlorophenyl)benzoate (PubChem CID 87359870) has the molecular formula C28H28Cl2N2O4 and a molecular weight of 527.45 g/mol. Its IUPAC name is [(2S)-5-amino-2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-5-oxopentanoyl] 4-(3-chlorophenyl)benzoate.
| Compound Name | [(2S)-5-amino-2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-5-oxopentanoyl] 4-(3-chlorophenyl)benzoate |
|---|---|
| PubChem CID | 87359870 |
| Molecular Formula | C28H28Cl2N2O4 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | [(2S)-5-amino-2-[[1-(4-chlorophenyl)-2-methylpropan-2-yl]amino]-5-oxopentanoyl] 4-(3-chlorophenyl)benzoate |
| SMILES | CC(C)(Cc1ccc(Cl)cc1)N[C@@H](CCC(N)=O)C(=O)OC(=O)c1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C28H28Cl2N2O4/c1-28(2,17-18-6-12-22(29)13-7-18)32-24(14-15-25(31)33)27(35)36-26(34)20-10-8-19(9-11-20)21-4-3-5-23(30)16-21/h3-13,16,24,32H,14-15,17H2,1-2H3,(H2,31,33)/t24-/m0/s1 |
| InChIKey | NOEVKRYLOVPHFD-DEOSSOPVSA-N |
| XLogP | 5.59 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|