C26H27BrN2O4S — CID 87360502
[(2S)-5-amino-2-[(2-methyl-1-phenylpropan-2-yl)amino]-5-oxopentanoyl] 4-(5-bromothiophen-2-yl)benzoate (PubChem CID 87360502) has the molecular formula C26H27BrN2O4S and a molecular weight of 543.48 g/mol. Its IUPAC name is [(2S)-5-amino-2-[(2-methyl-1-phenylpropan-2-yl)amino]-5-oxopentanoyl] 4-(5-bromothiophen-2-yl)benzoate.
| Compound Name | [(2S)-5-amino-2-[(2-methyl-1-phenylpropan-2-yl)amino]-5-oxopentanoyl] 4-(5-bromothiophen-2-yl)benzoate |
|---|---|
| PubChem CID | 87360502 |
| Molecular Formula | C26H27BrN2O4S |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | [(2S)-5-amino-2-[(2-methyl-1-phenylpropan-2-yl)amino]-5-oxopentanoyl] 4-(5-bromothiophen-2-yl)benzoate |
| SMILES | CC(C)(Cc1ccccc1)N[C@@H](CCC(N)=O)C(=O)OC(=O)c1ccc(-c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C26H27BrN2O4S/c1-26(2,16-17-6-4-3-5-7-17)29-20(12-15-23(28)30)25(32)33-24(31)19-10-8-18(9-11-19)21-13-14-22(27)34-21/h3-11,13-14,20,29H,12,15-16H2,1-2H3,(H2,28,30)/t20-/m0/s1 |
| InChIKey | SGIKXOKKYZRJRD-FQEVSTJZSA-N |
| XLogP | 5.11 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|