C30H34N2O9 — CID 87360332
[(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3,4-dimethoxyphenyl)benzoate (PubChem CID 87360332) has the molecular formula C30H34N2O9 and a molecular weight of 566.61 g/mol. Its IUPAC name is [(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3,4-dimethoxyphenyl)benzoate.
| Compound Name | [(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3,4-dimethoxyphenyl)benzoate |
|---|---|
| PubChem CID | 87360332 |
| Molecular Formula | C30H34N2O9 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | [(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3,4-dimethoxyphenyl)benzoate |
| SMILES | COc1ccc(-c2ccc(C(=O)OC(=O)[C@H](CCC(N)=O)NCc3cc(OC)c(OC)c(OC)c3)cc2)cc1OC |
| InChI | InChI=1S/C30H34N2O9/c1-36-23-12-10-21(16-24(23)37-2)19-6-8-20(9-7-19)29(34)41-30(35)22(11-13-27(31)33)32-17-18-14-25(38-3)28(40-5)26(15-18)39-4/h6-10,12,14-16,22,32H,11,13,17H2,1-5H3,(H2,31,33)/t22-/m0/s1 |
| InChIKey | OCZFKEKBSZTNBO-QFIPXVFZSA-N |
| XLogP | 3.50 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|