C29H31FN2O7 — CID 87361179
[(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3-fluoro-4-methylphenyl)benzoate (PubChem CID 87361179) has the molecular formula C29H31FN2O7 and a molecular weight of 538.57 g/mol. Its IUPAC name is [(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3-fluoro-4-methylphenyl)benzoate.
| Compound Name | [(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3-fluoro-4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 87361179 |
| Molecular Formula | C29H31FN2O7 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [(2S)-5-amino-5-oxo-2-[(3,4,5-trimethoxyphenyl)methylamino]pentanoyl] 4-(3-fluoro-4-methylphenyl)benzoate |
| SMILES | COc1cc(CN[C@@H](CCC(N)=O)C(=O)OC(=O)c2ccc(-c3ccc(C)c(F)c3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H31FN2O7/c1-17-5-6-21(15-22(17)30)19-7-9-20(10-8-19)28(34)39-29(35)23(11-12-26(31)33)32-16-18-13-24(36-2)27(38-4)25(14-18)37-3/h5-10,13-15,23,32H,11-12,16H2,1-4H3,(H2,31,33)/t23-/m0/s1 |
| InChIKey | AVZYUWGFMXRIQL-QHCPKHFHSA-N |
| XLogP | 3.93 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|