C39H42Br2O10 — CID 71590928
[(3R,5R)-5-(4-bromobenzoyl)oxy-1,7-bis(3,4,5-trimethoxyphenyl)heptan-3-yl] 4-bromobenzoate (PubChem CID 71590928) has the molecular formula C39H42Br2O10 and a molecular weight of 830.56 g/mol. Its IUPAC name is [(3R,5R)-5-(4-bromobenzoyl)oxy-1,7-bis(3,4,5-trimethoxyphenyl)heptan-3-yl] 4-bromobenzoate.
| Compound Name | [(3R,5R)-5-(4-bromobenzoyl)oxy-1,7-bis(3,4,5-trimethoxyphenyl)heptan-3-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 71590928 |
| Molecular Formula | C39H42Br2O10 |
| Molecular Weight | 830.56 g/mol |
| Exact Mass | 828.11 |
| IUPAC Name | [(3R,5R)-5-(4-bromobenzoyl)oxy-1,7-bis(3,4,5-trimethoxyphenyl)heptan-3-yl] 4-bromobenzoate |
| SMILES | COc1cc(CC[C@H](C[C@@H](CCc2cc(OC)c(OC)c(OC)c2)OC(=O)c2ccc(Br)cc2)OC(=O)c2ccc(Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C39H42Br2O10/c1-44-32-19-24(20-33(45-2)36(32)48-5)7-17-30(50-38(42)26-9-13-28(40)14-10-26)23-31(51-39(43)27-11-15-29(41)16-12-27)18-8-25-21-34(46-3)37(49-6)35(22-25)47-4/h9-16,19-22,30-31H,7-8,17-18,23H2,1-6H3/t30-,31-/m1/s1 |
| InChIKey | HCMAXMCYOJSNGB-FIRIVFDPSA-N |
| XLogP | 8.67 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.56 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |