C10H16N4O6S2 — CID 87362782
4-cyano-4-[(1-cyano-4-sulfobutyl)diazenyl]butane-1-sulfonic acid (PubChem CID 87362782) has the molecular formula C10H16N4O6S2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-cyano-4-[(1-cyano-4-sulfobutyl)diazenyl]butane-1-sulfonic acid.
| Compound Name | 4-cyano-4-[(1-cyano-4-sulfobutyl)diazenyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87362782 |
| Molecular Formula | C10H16N4O6S2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 4-cyano-4-[(1-cyano-4-sulfobutyl)diazenyl]butane-1-sulfonic acid |
| SMILES | N#CC(CCCS(=O)(=O)O)/N=N/C(C#N)CCCS(=O)(=O)O |
| InChI | InChI=1S/C10H16N4O6S2/c11-7-9(3-1-5-21(15,16)17)13-14-10(8-12)4-2-6-22(18,19)20/h9-10H,1-6H2,(H,15,16,17)(H,18,19,20)/b14-13+ |
| InChIKey | RHFYIVYSSZUURQ-BUHFOSPRSA-N |
| XLogP | 0.56 |
| TPSA | 181.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|