C10H26N8O12S2 — CID 139909262
tetraazanium;4-[(3-carboxylato-1-cyanopropyl)diazenyl]-4-cyanobutanoate;sulfonatooxy sulfate (PubChem CID 139909262) has the molecular formula C10H26N8O12S2 and a molecular weight of 514.50 g/mol. Its IUPAC name is tetraazanium;4-[(3-carboxylato-1-cyanopropyl)diazenyl]-4-cyanobutanoate;sulfonatooxy sulfate.
| Compound Name | tetraazanium;4-[(3-carboxylato-1-cyanopropyl)diazenyl]-4-cyanobutanoate;sulfonatooxy sulfate |
|---|---|
| PubChem CID | 139909262 |
| Molecular Formula | C10H26N8O12S2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | tetraazanium;4-[(3-carboxylato-1-cyanopropyl)diazenyl]-4-cyanobutanoate;sulfonatooxy sulfate |
| SMILES | N#CC(CCC(=O)[O-])/N=N/C(C#N)CCC(=O)[O-].O=S(=O)([O-])OOS(=O)(=O)[O-].[NH4+].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C10H12N4O4.4H3N.H2O8S2/c11-5-7(1-3-9(15)16)13-14-8(6-12)2-4-10(17)18;;;;;1-9(2,3)7-8-10(4,5)6/h7-8H,1-4H2,(H,15,16)(H,17,18);4*1H3;(H,1,2,3)(H,4,5,6)/b14-13+;;;;; |
| InChIKey | UQOMUFIHXSIJIA-ACQMDWLESA-N |
| XLogP | -2.36 |
| TPSA | 431.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|