About diazanium;sulfooxy sulfate;acetate
diazanium;sulfooxy sulfate;acetate (PubChem CID 140672983) has the molecular formula C2H12N2O10S2
and a molecular weight of 288.26 g/mol. Its IUPAC name is diazanium;sulfooxy sulfate;acetate.
Molecular Properties
| Compound Name | diazanium;sulfooxy sulfate;acetate |
| PubChem CID | 140672983 |
| Molecular Formula | C2H12N2O10S2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | diazanium;sulfooxy sulfate;acetate |
| SMILES | CC(=O)[O-].O=S(=O)([O-])OOS(=O)(=O)O.[NH4+].[NH4+] |
| InChI | InChI=1S/C2H4O2.2H3N.H2O8S2/c1-2(3)4;;;1-9(2,3)7-8-10(4,5)6/h1H3,(H,3,4);2*1H3;(H,1,2,3)(H,4,5,6) |
| InChIKey | RQTCSNMOEYVEKD-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 243.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze diazanium;sulfooxy sulfate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;sulfooxy sulfate;acetate?
The IUPAC name of diazanium;sulfooxy sulfate;acetate (CID 140672983) is diazanium;sulfooxy sulfate;acetate.
What is the SMILES notation for diazanium;sulfooxy sulfate;acetate?
The canonical SMILES for diazanium;sulfooxy sulfate;acetate is CC(=O)[O-].O=S(=O)([O-])OOS(=O)(=O)O.[NH4+].[NH4+].
What is the InChIKey of diazanium;sulfooxy sulfate;acetate?
The InChIKey is RQTCSNMOEYVEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.2H3N.H2O8S2/c1-2(3)4;;;1-9(2,3)7-8-10(4,5)6/h1H3,(H,3,4);2*1H3;(H,1,2,3)(H,4,5,6).
What are the key properties of diazanium;sulfooxy sulfate;acetate?
diazanium;sulfooxy sulfate;acetate has a molecular weight of 288.26 g/mol, XLogP of -2.29, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;sulfooxy sulfate;acetate is sourced from PubChem (CID 140672983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).