About bis(manganese(2+));acetate;sulfate
bis(manganese(2+));acetate;sulfate (PubChem CID 19995630) has the molecular formula C2H3Mn2O6S+
and a molecular weight of 264.98 g/mol. Its IUPAC name is bis(manganese(2+));acetate;sulfate.
Molecular Properties
| Compound Name | bis(manganese(2+));acetate;sulfate |
| PubChem CID | 19995630 |
| Molecular Formula | C2H3Mn2O6S+ |
| Molecular Weight | 264.98 g/mol |
| Exact Mass | 264.84 |
| IUPAC Name | bis(manganese(2+));acetate;sulfate |
| SMILES | CC(=O)[O-].O=S(=O)([O-])[O-].[Mn+2].[Mn+2] |
| InChI | InChI=1S/C2H4O2.2Mn.H2O4S/c1-2(3)4;;;1-5(2,3)4/h1H3,(H,3,4);;;(H2,1,2,3,4)/q;2*+2;/p-3 |
| InChIKey | XUAHEINXSOBFQF-UHFFFAOYSA-K |
| XLogP | -2.59 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.98 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(manganese(2+));acetate;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(manganese(2+));acetate;sulfate?
The IUPAC name of bis(manganese(2+));acetate;sulfate (CID 19995630) is bis(manganese(2+));acetate;sulfate.
What is the SMILES notation for bis(manganese(2+));acetate;sulfate?
The canonical SMILES for bis(manganese(2+));acetate;sulfate is CC(=O)[O-].O=S(=O)([O-])[O-].[Mn+2].[Mn+2].
What is the InChIKey of bis(manganese(2+));acetate;sulfate?
The InChIKey is XUAHEINXSOBFQF-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H4O2.2Mn.H2O4S/c1-2(3)4;;;1-5(2,3)4/h1H3,(H,3,4);;;(H2,1,2,3,4)/q;2*+2;/p-3.
What are the key properties of bis(manganese(2+));acetate;sulfate?
bis(manganese(2+));acetate;sulfate has a molecular weight of 264.98 g/mol, XLogP of -2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(manganese(2+));acetate;sulfate is sourced from PubChem (CID 19995630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).