C13H29NSi — CID 87363029
N-(tert-butyl-ethenyl-propan-2-ylsilyl)-N-ethylethanamine (PubChem CID 87363029) has the molecular formula C13H29NSi and a molecular weight of 227.47 g/mol. Its IUPAC name is N-(tert-butyl-ethenyl-propan-2-ylsilyl)-N-ethylethanamine.
| Compound Name | N-(tert-butyl-ethenyl-propan-2-ylsilyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 87363029 |
| Molecular Formula | C13H29NSi |
| Molecular Weight | 227.47 g/mol |
| Exact Mass | 227.21 |
| IUPAC Name | N-(tert-butyl-ethenyl-propan-2-ylsilyl)-N-ethylethanamine |
| SMILES | C=C[Si](C(C)C)(N(CC)CC)C(C)(C)C |
| InChI | InChI=1S/C13H29NSi/c1-9-14(10-2)15(11-3,12(4)5)13(6,7)8/h11-12H,3,9-10H2,1-2,4-8H3 |
| InChIKey | RLYFMPYDGLTDLA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|