C28H54N2 — CID 159412930
(1E)-N,N-diethyl-3,5,5-trimethylhepta-1,6-dien-1-amine (PubChem CID 159412930) has the molecular formula C28H54N2 and a molecular weight of 418.75 g/mol. Its IUPAC name is (1E)-N,N-diethyl-3,5,5-trimethylhepta-1,6-dien-1-amine.
| Compound Name | (1E)-N,N-diethyl-3,5,5-trimethylhepta-1,6-dien-1-amine |
|---|---|
| PubChem CID | 159412930 |
| Molecular Formula | C28H54N2 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.43 |
| IUPAC Name | (1E)-N,N-diethyl-3,5,5-trimethylhepta-1,6-dien-1-amine |
| SMILES | C=CC(C)(C)CC(C)/C=C/N(CC)CC.C=CC(C)(C)CC(C)/C=C/N(CC)CC |
| InChI | InChI=1S/2C14H27N/c2*1-7-14(5,6)12-13(4)10-11-15(8-2)9-3/h2*7,10-11,13H,1,8-9,12H2,2-6H3/b2*11-10+ |
| InChIKey | LOUNURNMQDCAFD-YFGZYSTASA-N |
| XLogP | 8.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|