C15H31NO — CID 88680595
N,N-diethyl-7-methoxy-3,7-dimethyloct-1-en-1-amine (PubChem CID 88680595) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is N,N-diethyl-7-methoxy-3,7-dimethyloct-1-en-1-amine.
| Compound Name | N,N-diethyl-7-methoxy-3,7-dimethyloct-1-en-1-amine |
|---|---|
| PubChem CID | 88680595 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | N,N-diethyl-7-methoxy-3,7-dimethyloct-1-en-1-amine |
| SMILES | CCN(C=CC(C)CCCC(C)(C)OC)CC |
| InChI | InChI=1S/C15H31NO/c1-7-16(8-2)13-11-14(3)10-9-12-15(4,5)17-6/h11,13-14H,7-10,12H2,1-6H3 |
| InChIKey | YIZAHTMRGWDDJC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |