About (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine
(Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine (PubChem CID 167218040) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine.
Analyze (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine?
The IUPAC name of (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine (CID 167218040) is (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine.
What is the SMILES notation for (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine?
The canonical SMILES for (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine is C=CN(/C=C\C(C)C(C)C)CC.
What is the InChIKey of (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine?
The InChIKey is SPGPVNQNWYMBHY-HJWRWDBZSA-N. The full InChI is InChI=1S/C11H21N/c1-6-12(7-2)9-8-11(5)10(3)4/h6,8-11H,1,7H2,2-5H3/b9-8-.
What are the key properties of (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine?
(Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine has a molecular weight of 167.30 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethenyl-N-ethyl-3,4-dimethylpent-1-en-1-amine is sourced from PubChem (CID 167218040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).