C24H46BN — CID 174195812
N-[2,2-dimethylbut-3-enyl(methyl)boranyl]-N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethylhex-5-en-2-amine (PubChem CID 174195812) has the molecular formula C24H46BN and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[2,2-dimethylbut-3-enyl(methyl)boranyl]-N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethylhex-5-en-2-amine.
| Compound Name | N-[2,2-dimethylbut-3-enyl(methyl)boranyl]-N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethylhex-5-en-2-amine |
|---|---|
| PubChem CID | 174195812 |
| Molecular Formula | C24H46BN |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.37 |
| IUPAC Name | N-[2,2-dimethylbut-3-enyl(methyl)boranyl]-N-(4,4-dimethylhex-5-en-2-yl)-2,4,4-trimethylhex-5-en-2-amine |
| SMILES | C=CC(C)(C)CB(C)N(C(C)CC(C)(C)C=C)C(C)(C)CC(C)(C)C=C |
| InChI | InChI=1S/C24H46BN/c1-14-21(5,6)17-20(4)26(25(13)19-23(9,10)16-3)24(11,12)18-22(7,8)15-2/h14-16,20H,1-3,17-19H2,4-13H3 |
| InChIKey | FZEYGKRFENKHGT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|