C9H13BrClN3O — CID 87364003
4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide;hydrochloride (PubChem CID 87364003) has the molecular formula C9H13BrClN3O and a molecular weight of 294.58 g/mol. Its IUPAC name is 4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide;hydrochloride.
| Compound Name | 4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 87364003 |
| Molecular Formula | C9H13BrClN3O |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 4-bromo-N'-(2-hydroxyethylamino)benzenecarboximidamide;hydrochloride |
| SMILES | Cl.N/C(=N\NCCO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H12BrN3O.ClH/c10-8-3-1-7(2-4-8)9(11)13-12-5-6-14;/h1-4,12,14H,5-6H2,(H2,11,13);1H |
| InChIKey | ROQZOFCJKHFGDA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|