C16H18N2O5S2 — CID 8736405
[2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8736405) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8736405 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)COC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-11-6-13(24-10-17)2-3-14(11)18-15(19)8-23-16(20)7-12-4-5-25(21,22)9-12/h2-3,6,12H,4-5,7-9H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | SEEGALAHMSRGAO-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|