C19H25NO5 — CID 8736698
[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8736698) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8736698 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOc1ccc2oc(C(=O)O[C@@H](C)C(=O)NC(C)(C)C)c(C)c2c1 |
| InChI | InChI=1S/C19H25NO5/c1-7-23-13-8-9-15-14(10-13)11(2)16(25-15)18(22)24-12(3)17(21)20-19(4,5)6/h8-10,12H,7H2,1-6H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | BEQNDAROXVHNCL-LBPRGKRZSA-N |
| XLogP | 3.60 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |