C22H22N2O8 — CID 3465132
[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 3465132) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 3465132 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 5-ethoxy-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOc1ccc2oc(C(=O)OC(C)C(=O)Nc3cc([N+](=O)[O-])ccc3OC)c(C)c2c1 |
| InChI | InChI=1S/C22H22N2O8/c1-5-30-15-7-9-18-16(11-15)12(2)20(32-18)22(26)31-13(3)21(25)23-17-10-14(24(27)28)6-8-19(17)29-4/h6-11,13H,5H2,1-4H3,(H,23,25) |
| InChIKey | PKMWYBYHDOXBFH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|