C22H23NO4S — CID 87367120
[4-[(1R)-1-hydroxy-2-(1-phenylethylamino)ethyl]phenyl] benzenesulfonate (PubChem CID 87367120) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is [4-[(1R)-1-hydroxy-2-(1-phenylethylamino)ethyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(1R)-1-hydroxy-2-(1-phenylethylamino)ethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 87367120 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [4-[(1R)-1-hydroxy-2-(1-phenylethylamino)ethyl]phenyl] benzenesulfonate |
| SMILES | CC(NC[C@H](O)c1ccc(OS(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4S/c1-17(18-8-4-2-5-9-18)23-16-22(24)19-12-14-20(15-13-19)27-28(25,26)21-10-6-3-7-11-21/h2-15,17,22-24H,16H2,1H3/t17?,22-/m0/s1 |
| InChIKey | YIQHGBZUSYJICZ-UGNFMNBCSA-N |
| XLogP | 3.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|