C18H23NO4S — CID 87367413
[4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]phenyl] benzenesulfonate (PubChem CID 87367413) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 87367413 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]phenyl] benzenesulfonate |
| SMILES | CC(C)(C)NC[C@H](O)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23NO4S/c1-18(2,3)19-13-17(20)14-9-11-15(12-10-14)23-24(21,22)16-7-5-4-6-8-16/h4-12,17,19-20H,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | LUTCWNRHLSTXDG-KRWDZBQOSA-N |
| XLogP | 2.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|