C17H15F2IN6O — CID 87369260
1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-1-iodourea (PubChem CID 87369260) has the molecular formula C17H15F2IN6O and a molecular weight of 484.25 g/mol. Its IUPAC name is 1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-1-iodourea.
| Compound Name | 1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-1-iodourea |
|---|---|
| PubChem CID | 87369260 |
| Molecular Formula | C17H15F2IN6O |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]-1-iodourea |
| SMILES | NC(=O)N(I)c1cnc2ccc(N3CCCC3c3cc(F)ccc3F)nn12 |
| InChI | InChI=1S/C17H15F2IN6O/c18-10-3-4-12(19)11(8-10)13-2-1-7-24(13)15-6-5-14-22-9-16(26(14)23-15)25(20)17(21)27/h3-6,8-9,13H,1-2,7H2,(H2,21,27) |
| InChIKey | IXUPUVLZWFUZLH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|