C22H19F2N5 — CID 89131016
4-[6-[(2S)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]aniline (PubChem CID 89131016) has the molecular formula C22H19F2N5 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-[6-[(2S)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]aniline.
| Compound Name | 4-[6-[(2S)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]aniline |
|---|---|
| PubChem CID | 89131016 |
| Molecular Formula | C22H19F2N5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[6-[(2S)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]aniline |
| SMILES | Nc1ccc(-c2cnc3ccc(N4CCC[C@H]4c4cc(F)ccc4F)nn23)cc1 |
| InChI | InChI=1S/C22H19F2N5/c23-15-5-8-18(24)17(12-15)19-2-1-11-28(19)22-10-9-21-26-13-20(29(21)27-22)14-3-6-16(25)7-4-14/h3-10,12-13,19H,1-2,11,25H2/t19-/m0/s1 |
| InChIKey | CFPFZYTVEPHKDJ-IBGZPJMESA-N |
| XLogP | 4.60 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|