C9H15NO3 — CID 87369583
ethyl (E)-2-methyl-3-(1,3-oxazolidin-2-yl)prop-2-enoate (PubChem CID 87369583) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-(1,3-oxazolidin-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-2-methyl-3-(1,3-oxazolidin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 87369583 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethyl (E)-2-methyl-3-(1,3-oxazolidin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C1NCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-3-12-9(11)7(2)6-8-10-4-5-13-8/h6,8,10H,3-5H2,1-2H3/b7-6+ |
| InChIKey | ZDEFFPNWDJKNJH-VOTSOKGWSA-N |
| XLogP | 0.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|