C16H38N4O4 — CID 87370763
2,6-diaminohexanoic acid;(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butan-1-ol (PubChem CID 87370763) has the molecular formula C16H38N4O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butan-1-ol.
| Compound Name | 2,6-diaminohexanoic acid;(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 87370763 |
| Molecular Formula | C16H38N4O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2,6-diaminohexanoic acid;(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butan-1-ol |
| SMILES | CC[C@@H](CO)NCCN[C@@H](CC)CO.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C10H24N2O2.C6H14N2O2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14;7-4-2-1-3-5(8)6(9)10/h9-14H,3-8H2,1-2H3;5H,1-4,7-8H2,(H,9,10)/t9-,10-;/m0./s1 |
| InChIKey | PNGSNCUKHYEMDL-IYPAPVHQSA-N |
| XLogP | -0.77 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|