About N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine
N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine (PubChem CID 87370811) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine.
Molecular Properties
| Compound Name | N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine |
| PubChem CID | 87370811 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine |
| SMILES | C#CC(CCCCC)NC.C#CCN(C)C(C)CCC |
| InChI | InChI=1S/2C9H17N/c1-5-7-9(3)10(4)8-6-2;1-4-6-7-8-9(5-2)10-3/h2,9H,5,7-8H2,1,3-4H3;2,9-10H,4,6-8H2,1,3H3 |
| InChIKey | LJMGHDNCRBXCPM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine?
The IUPAC name of N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine (CID 87370811) is N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine.
What is the SMILES notation for N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine?
The canonical SMILES for N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine is C#CC(CCCCC)NC.C#CCN(C)C(C)CCC.
What is the InChIKey of N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine?
The InChIKey is LJMGHDNCRBXCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H17N/c1-5-7-9(3)10(4)8-6-2;1-4-6-7-8-9(5-2)10-3/h2,9H,5,7-8H2,1,3-4H3;2,9-10H,4,6-8H2,1,3H3.
What are the key properties of N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine?
N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine has a molecular weight of 278.48 g/mol, XLogP of 3.53, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyloct-1-yn-3-amine;N-methyl-N-prop-2-ynylpentan-2-amine is sourced from PubChem (CID 87370811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).