About 4-ethynyldodecane
4-ethynyldodecane (PubChem CID 15570330) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 4-ethynyldodecane.
Molecular Properties
| Compound Name | 4-ethynyldodecane |
| PubChem CID | 15570330 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 4-ethynyldodecane |
| SMILES | C#CC(CCC)CCCCCCCC |
| InChI | InChI=1S/C14H26/c1-4-7-8-9-10-11-13-14(6-3)12-5-2/h3,14H,4-5,7-13H2,1-2H3 |
| InChIKey | ZYKSSKCSOQQXOT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyldodecane?
The IUPAC name of 4-ethynyldodecane (CID 15570330) is 4-ethynyldodecane.
What is the SMILES notation for 4-ethynyldodecane?
The canonical SMILES for 4-ethynyldodecane is C#CC(CCC)CCCCCCCC.
What is the InChIKey of 4-ethynyldodecane?
The InChIKey is ZYKSSKCSOQQXOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26/c1-4-7-8-9-10-11-13-14(6-3)12-5-2/h3,14H,4-5,7-13H2,1-2H3.
What are the key properties of 4-ethynyldodecane?
4-ethynyldodecane has a molecular weight of 194.36 g/mol, XLogP of 4.79, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyldodecane is sourced from PubChem (CID 15570330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).